C19H18N2O2 — CID 155140615
(4R)-N-phenyl-2-prop-2-enoyl-3,4-dihydro-1H-isoquinoline-4-carboxamide (PubChem CID 155140615) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (4R)-N-phenyl-2-prop-2-enoyl-3,4-dihydro-1H-isoquinoline-4-carboxamide.
| Compound Name | (4R)-N-phenyl-2-prop-2-enoyl-3,4-dihydro-1H-isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 155140615 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (4R)-N-phenyl-2-prop-2-enoyl-3,4-dihydro-1H-isoquinoline-4-carboxamide |
| SMILES | C=CC(=O)N1Cc2ccccc2[C@@H](C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C19H18N2O2/c1-2-18(22)21-12-14-8-6-7-11-16(14)17(13-21)19(23)20-15-9-4-3-5-10-15/h2-11,17H,1,12-13H2,(H,20,23)/t17-/m0/s1 |
| InChIKey | UQSHPGWMADDDQS-KRWDZBQOSA-N |
| XLogP | 2.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|