About 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one
1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 164785802) has the molecular formula C24H21NO
and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| PubChem CID | 164785802 |
| Molecular Formula | C24H21NO |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2ccc(-c3ccccc3)cc2[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C24H21NO/c1-2-24(26)25-16-21-14-13-20(18-9-5-3-6-10-18)15-22(21)23(17-25)19-11-7-4-8-12-19/h2-15,23H,1,16-17H2/t23-/m0/s1 |
| InChIKey | GCCNTXHFCIEJLK-QHCPKHFHSA-N |
| XLogP | 5.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one?
The IUPAC name of 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (CID 164785802) is 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
What is the SMILES notation for 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one?
The canonical SMILES for 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one is C=CC(=O)N1Cc2ccc(-c3ccccc3)cc2[C@H](c2ccccc2)C1.
What is the InChIKey of 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one?
The InChIKey is GCCNTXHFCIEJLK-QHCPKHFHSA-N. The full InChI is InChI=1S/C24H21NO/c1-2-24(26)25-16-21-14-13-20(18-9-5-3-6-10-18)15-22(21)23(17-25)19-11-7-4-8-12-19/h2-15,23H,1,16-17H2/t23-/m0/s1.
What are the key properties of 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one?
1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one has a molecular weight of 339.44 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-4,6-diphenyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one is sourced from PubChem (CID 164785802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).