C19H16N2O — CID 155698417
(4S)-4-phenyl-2-prop-2-enoyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile (PubChem CID 155698417) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is (4S)-4-phenyl-2-prop-2-enoyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile.
| Compound Name | (4S)-4-phenyl-2-prop-2-enoyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 155698417 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (4S)-4-phenyl-2-prop-2-enoyl-3,4-dihydro-1H-isoquinoline-7-carbonitrile |
| SMILES | C=CC(=O)N1Cc2cc(C#N)ccc2[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H16N2O/c1-2-19(22)21-12-16-10-14(11-20)8-9-17(16)18(13-21)15-6-4-3-5-7-15/h2-10,18H,1,12-13H2/t18-/m0/s1 |
| InChIKey | JXWWDVKAJUWRCH-SFHVURJKSA-N |
| XLogP | 3.22 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|