C38H38N2O2 — CID 165027492
1-[(5S)-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]prop-2-en-1-one;1-[(5R)-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]prop-2-en-1-one (PubChem CID 165027492) has the molecular formula C38H38N2O2 and a molecular weight of 554.73 g/mol. Its IUPAC name is 1-[(5S)-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]prop-2-en-1-one;1-[(5R)-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]prop-2-en-1-one.
| Compound Name | 1-[(5S)-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]prop-2-en-1-one;1-[(5R)-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 165027492 |
| Molecular Formula | C38H38N2O2 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 1-[(5S)-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]prop-2-en-1-one;1-[(5R)-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2ccccc2[C@@H](c2ccccc2)C1.C=CC(=O)N1CCc2ccccc2[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/2C19H19NO/c2*1-2-19(21)20-13-12-16-10-6-7-11-17(16)18(14-20)15-8-4-3-5-9-15/h2*2-11,18H,1,12-14H2/t2*18-/m10/s1 |
| InChIKey | MCVGJBBIISUHHO-JJMXQKMNSA-N |
| XLogP | 6.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|