C21H23N — CID 155140742
2-buta-1,3-dien-2-yl-6-ethyl-4-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 155140742) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-6-ethyl-4-phenyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-buta-1,3-dien-2-yl-6-ethyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 155140742 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-6-ethyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C=CC(=C)N1Cc2ccc(CC)cc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C21H23N/c1-4-16(3)22-14-19-12-11-17(5-2)13-20(19)21(15-22)18-9-7-6-8-10-18/h4,6-13,21H,1,3,5,14-15H2,2H3 |
| InChIKey | FMKNFQIKCNXDHH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|