C16H15BrClNOS — CID 155140654
2-bromo-1-[(4R)-2-chloro-4-(2-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethanone (PubChem CID 155140654) has the molecular formula C16H15BrClNOS and a molecular weight of 384.73 g/mol. Its IUPAC name is 2-bromo-1-[(4R)-2-chloro-4-(2-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethanone.
| Compound Name | 2-bromo-1-[(4R)-2-chloro-4-(2-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethanone |
|---|---|
| PubChem CID | 155140654 |
| Molecular Formula | C16H15BrClNOS |
| Molecular Weight | 384.73 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | 2-bromo-1-[(4R)-2-chloro-4-(2-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethanone |
| SMILES | Cc1ccccc1[C@H]1CN(C(=O)CBr)Cc2sc(Cl)cc21 |
| InChI | InChI=1S/C16H15BrClNOS/c1-10-4-2-3-5-11(10)13-8-19(16(20)7-17)9-14-12(13)6-15(18)21-14/h2-6,13H,7-9H2,1H3/t13-/m1/s1 |
| InChIKey | SSVRTCSVLYOPCP-CYBMUJFWSA-N |
| XLogP | 4.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|