C18H17BrClNOS — CID 155140660
(E)-4-bromo-1-[(4R)-2-chloro-4-(2-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]but-2-en-1-one (PubChem CID 155140660) has the molecular formula C18H17BrClNOS and a molecular weight of 410.76 g/mol. Its IUPAC name is (E)-4-bromo-1-[(4R)-2-chloro-4-(2-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]but-2-en-1-one.
| Compound Name | (E)-4-bromo-1-[(4R)-2-chloro-4-(2-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 155140660 |
| Molecular Formula | C18H17BrClNOS |
| Molecular Weight | 410.76 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | (E)-4-bromo-1-[(4R)-2-chloro-4-(2-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]but-2-en-1-one |
| SMILES | Cc1ccccc1[C@H]1CN(C(=O)/C=C/CBr)Cc2sc(Cl)cc21 |
| InChI | InChI=1S/C18H17BrClNOS/c1-12-5-2-3-6-13(12)15-10-21(18(22)7-4-8-19)11-16-14(15)9-17(20)23-16/h2-7,9,15H,8,10-11H2,1H3/b7-4+/t15-/m1/s1 |
| InChIKey | DEBMFPJJSFIBFN-NFBGWVBBSA-N |
| XLogP | 5.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.76 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|