C17H16BrNOS — CID 155140996
1-[(7S)-2-bromo-7-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]prop-2-en-1-one (PubChem CID 155140996) has the molecular formula C17H16BrNOS and a molecular weight of 362.29 g/mol. Its IUPAC name is 1-[(7S)-2-bromo-7-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[(7S)-2-bromo-7-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155140996 |
| Molecular Formula | C17H16BrNOS |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-[(7S)-2-bromo-7-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2cc(Br)sc2[C@@H](c2ccccc2C)C1 |
| InChI | InChI=1S/C17H16BrNOS/c1-3-16(20)19-9-12-8-15(18)21-17(12)14(10-19)13-7-5-4-6-11(13)2/h3-8,14H,1,9-10H2,2H3/t14-/m1/s1 |
| InChIKey | BNRATHLYNAQNEP-CQSZACIVSA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|