About 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline
4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline (PubChem CID 155141679) has the molecular formula C12H8FN5O4
and a molecular weight of 305.23 g/mol. Its IUPAC name is 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline.
Molecular Properties
| Compound Name | 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline |
| PubChem CID | 155141679 |
| Molecular Formula | C12H8FN5O4 |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline |
| SMILES | Nc1ccc(/N=N/c2cc(F)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H8FN5O4/c13-9-5-10(12(18(21)22)6-11(9)17(19)20)16-15-8-3-1-7(14)2-4-8/h1-6H,14H2/b16-15+ |
| InChIKey | DSDYKKZZULUCEO-FOCLMDBBSA-N |
| XLogP | 3.64 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline?
The IUPAC name of 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline (CID 155141679) is 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline.
What is the SMILES notation for 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline?
The canonical SMILES for 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline is Nc1ccc(/N=N/c2cc(F)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1.
What is the InChIKey of 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline?
The InChIKey is DSDYKKZZULUCEO-FOCLMDBBSA-N. The full InChI is InChI=1S/C12H8FN5O4/c13-9-5-10(12(18(21)22)6-11(9)17(19)20)16-15-8-3-1-7(14)2-4-8/h1-6H,14H2/b16-15+.
What are the key properties of 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline?
4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline has a molecular weight of 305.23 g/mol, XLogP of 3.64, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-fluoro-2,4-dinitrophenyl)diazenyl]aniline is sourced from PubChem (CID 155141679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).