C14H19ClN2O2 — CID 155146217
[1-[[1-(3-chlorophenyl)cyclopropyl]amino]-2-methylpropan-2-yl]carbamic acid (PubChem CID 155146217) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is [1-[[1-(3-chlorophenyl)cyclopropyl]amino]-2-methylpropan-2-yl]carbamic acid.
| Compound Name | [1-[[1-(3-chlorophenyl)cyclopropyl]amino]-2-methylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 155146217 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [1-[[1-(3-chlorophenyl)cyclopropyl]amino]-2-methylpropan-2-yl]carbamic acid |
| SMILES | CC(C)(CNC1(c2cccc(Cl)c2)CC1)NC(=O)O |
| InChI | InChI=1S/C14H19ClN2O2/c1-13(2,17-12(18)19)9-16-14(6-7-14)10-4-3-5-11(15)8-10/h3-5,8,16-17H,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | RWCUZYHVMVDDAT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |