C24H27N7O2S2 — CID 155148093
N-[3-[5-(2-aminopyrimidin-5-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide (PubChem CID 155148093) has the molecular formula C24H27N7O2S2 and a molecular weight of 509.66 g/mol. Its IUPAC name is N-[3-[5-(2-aminopyrimidin-5-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide.
| Compound Name | N-[3-[5-(2-aminopyrimidin-5-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
|---|---|
| PubChem CID | 155148093 |
| Molecular Formula | C24H27N7O2S2 |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | N-[3-[5-(2-aminopyrimidin-5-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4cnc(N)nc4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C24H27N7O2S2/c1-33-9-8-26-7-5-20(32)31-23-21(16-4-6-27-13-19(16)35-23)22-30-17-10-14(2-3-18(17)34-22)15-11-28-24(25)29-12-15/h2-3,10-12,26-27H,4-9,13H2,1H3,(H,31,32)(H2,25,28,29) |
| InChIKey | VTFCYKJQZMZOOY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|