C24H26F4N4O3S2 — CID 155148138
(4S)-4-[(2R,4R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-4-(trifluoromethyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 155148138) has the molecular formula C24H26F4N4O3S2 and a molecular weight of 558.62 g/mol. Its IUPAC name is (4S)-4-[(2R,4R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-4-(trifluoromethyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | (4S)-4-[(2R,4R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-4-(trifluoromethyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 155148138 |
| Molecular Formula | C24H26F4N4O3S2 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | (4S)-4-[(2R,4R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-4-(trifluoromethyl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | C=C(/C=C\C(F)=C/C)[C@H]1C[C@H](C(F)(F)F)CCN1[C@H]1CCOc2cc(S(=O)(=O)Nc3ncns3)ccc21 |
| InChI | InChI=1S/C24H26F4N4O3S2/c1-3-17(25)5-4-15(2)21-12-16(24(26,27)28)8-10-32(21)20-9-11-35-22-13-18(6-7-19(20)22)37(33,34)31-23-29-14-30-36-23/h3-7,13-14,16,20-21H,2,8-12H2,1H3,(H,29,30,31)/b5-4-,17-3+/t16-,20+,21-/m1/s1 |
| InChIKey | WPIOBICXNMMONB-OZEGRVMUSA-N |
| XLogP | 5.79 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|