About [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene
[(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene (PubChem CID 155148351) has the molecular formula C14H25N3
and a molecular weight of 235.38 g/mol. Its IUPAC name is [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene.
Molecular Properties
| Compound Name | [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene |
| PubChem CID | 155148351 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene |
| SMILES | C=C(/C=C\N=N\C)[C@H]1CCCCN1C(C)(C)C |
| InChI | InChI=1S/C14H25N3/c1-12(9-10-16-15-5)13-8-6-7-11-17(13)14(2,3)4/h9-10,13H,1,6-8,11H2,2-5H3/b10-9-,16-15+/t13-/m1/s1 |
| InChIKey | WPKAFCFUPMPQSE-KQAIEJJJSA-N |
| XLogP | 3.79 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene?
The IUPAC name of [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene (CID 155148351) is [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene.
What is the SMILES notation for [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene?
The canonical SMILES for [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene is C=C(/C=C\N=N\C)[C@H]1CCCCN1C(C)(C)C.
What is the InChIKey of [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene?
The InChIKey is WPKAFCFUPMPQSE-KQAIEJJJSA-N. The full InChI is InChI=1S/C14H25N3/c1-12(9-10-16-15-5)13-8-6-7-11-17(13)14(2,3)4/h9-10,13H,1,6-8,11H2,2-5H3/b10-9-,16-15+/t13-/m1/s1.
What are the key properties of [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene?
[(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene has a molecular weight of 235.38 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z)-3-[(2R)-1-tert-butylpiperidin-2-yl]buta-1,3-dienyl]-methyldiazene is sourced from PubChem (CID 155148351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).