C11H13FN6O4 — CID 155149152
4-amino-1-[(2R,3R,4R,5R)-5-(1-azidoethenyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 155149152) has the molecular formula C11H13FN6O4 and a molecular weight of 312.26 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R,5R)-5-(1-azidoethenyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R,5R)-5-(1-azidoethenyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 155149152 |
| Molecular Formula | C11H13FN6O4 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-5-(1-azidoethenyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | C=C(N=[N+]=[N-])[C@]1(CO)O[C@@H](n2ccc(N)nc2=O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C11H13FN6O4/c1-5(16-17-14)11(4-19)8(20)7(12)9(22-11)18-3-2-6(13)15-10(18)21/h2-3,7-9,19-20H,1,4H2,(H2,13,15,21)/t7-,8+,9-,11+/m1/s1 |
| InChIKey | IIXJTCJKGLLLGB-LOKLDPHHSA-N |
| XLogP | -0.39 |
| TPSA | 159.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|