C11H15FN6O5 — CID 155466139
4-amino-1-[(2R,3S,4R,5R)-5-(2-azidoethoxy)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 155466139) has the molecular formula C11H15FN6O5 and a molecular weight of 330.28 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,4R,5R)-5-(2-azidoethoxy)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,4R,5R)-5-(2-azidoethoxy)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 155466139 |
| Molecular Formula | C11H15FN6O5 |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-amino-1-[(2R,3S,4R,5R)-5-(2-azidoethoxy)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | [N-]=[N+]=NCCO[C@]1(CO)O[C@@H](n2ccc(N)nc2=O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C11H15FN6O5/c12-7-8(20)11(5-19,22-4-2-15-17-14)23-9(7)18-3-1-6(13)16-10(18)21/h1,3,7-9,19-20H,2,4-5H2,(H2,13,16,21)/t7-,8-,9+,11+/m0/s1 |
| InChIKey | NKGMYMDNXWWTEA-WYOJIJJFSA-N |
| XLogP | -0.93 |
| TPSA | 168.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|