C12H15FN6O5 — CID 174013427
[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] 3-azidopropanoate (PubChem CID 174013427) has the molecular formula C12H15FN6O5 and a molecular weight of 342.29 g/mol. Its IUPAC name is [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] 3-azidopropanoate.
| Compound Name | [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] 3-azidopropanoate |
|---|---|
| PubChem CID | 174013427 |
| Molecular Formula | C12H15FN6O5 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] 3-azidopropanoate |
| SMILES | [N-]=[N+]=NCCC(=O)OC1C(F)[C@H](n2ccc(N)nc2=O)O[C@@H]1CO |
| InChI | InChI=1S/C12H15FN6O5/c13-9-10(24-8(21)1-3-16-18-15)6(5-20)23-11(9)19-4-2-7(14)17-12(19)22/h2,4,6,9-11,20H,1,3,5H2,(H2,14,17,22)/t6-,9?,10?,11-/m1/s1 |
| InChIKey | FSZFRNZKBYKASO-XLMFWOJCSA-N |
| XLogP | -0.33 |
| TPSA | 165.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|