C25H48FN7O — CID 155150627
3,3-diamino-2-(3-fluoro-6-pentyl-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide (PubChem CID 155150627) has the molecular formula C25H48FN7O and a molecular weight of 481.71 g/mol. Its IUPAC name is 3,3-diamino-2-(3-fluoro-6-pentyl-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(3-fluoro-6-pentyl-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 155150627 |
| Molecular Formula | C25H48FN7O |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.39 |
| IUPAC Name | 3,3-diamino-2-(3-fluoro-6-pentyl-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide |
| SMILES | CCCCCC12CCC(F)CN1C(C(C(=O)NC1CNCCC1N1CCN(C)CC1)C(N)N)C2 |
| InChI | InChI=1S/C25H48FN7O/c1-3-4-5-8-25-9-6-18(26)17-33(25)21(15-25)22(23(27)28)24(34)30-19-16-29-10-7-20(19)32-13-11-31(2)12-14-32/h18-23,29H,3-17,27-28H2,1-2H3,(H,30,34) |
| InChIKey | SRUWJROSYUJHGB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|