C27H49ClFN7O — CID 155150666
3,3-diamino-N-[5-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)piperidin-3-yl]-2-(11-fluoro-9-azaspiro[5.7]tridecan-8-yl)propanamide (PubChem CID 155150666) has the molecular formula C27H49ClFN7O and a molecular weight of 542.19 g/mol. Its IUPAC name is 3,3-diamino-N-[5-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)piperidin-3-yl]-2-(11-fluoro-9-azaspiro[5.7]tridecan-8-yl)propanamide.
| Compound Name | 3,3-diamino-N-[5-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)piperidin-3-yl]-2-(11-fluoro-9-azaspiro[5.7]tridecan-8-yl)propanamide |
|---|---|
| PubChem CID | 155150666 |
| Molecular Formula | C27H49ClFN7O |
| Molecular Weight | 542.19 g/mol |
| Exact Mass | 541.37 |
| IUPAC Name | 3,3-diamino-N-[5-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)piperidin-3-yl]-2-(11-fluoro-9-azaspiro[5.7]tridecan-8-yl)propanamide |
| SMILES | CN1CC2CN(C3C(Cl)CNCC3NC(=O)C(C(N)N)C3CC4(CCCCC4)CCC(F)CN3)CC2C1 |
| InChI | InChI=1S/C27H49ClFN7O/c1-35-13-17-15-36(16-18(17)14-35)24-20(28)11-32-12-22(24)34-26(37)23(25(30)31)21-9-27(6-3-2-4-7-27)8-5-19(29)10-33-21/h17-25,32-33H,2-16,30-31H2,1H3,(H,34,37) |
| InChIKey | FWAPZBSBFZLUCD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|