C32H57FN6O2 — CID 155151048
3,3-diamino-N-[6-cyclohexyl-4-(4-methoxypiperidin-1-yl)piperidin-3-yl]-2-[(12Z)-11-fluoro-9-azaspiro[5.7]tridec-12-en-8-yl]propanamide (PubChem CID 155151048) has the molecular formula C32H57FN6O2 and a molecular weight of 576.85 g/mol. Its IUPAC name is 3,3-diamino-N-[6-cyclohexyl-4-(4-methoxypiperidin-1-yl)piperidin-3-yl]-2-[(12Z)-11-fluoro-9-azaspiro[5.7]tridec-12-en-8-yl]propanamide.
| Compound Name | 3,3-diamino-N-[6-cyclohexyl-4-(4-methoxypiperidin-1-yl)piperidin-3-yl]-2-[(12Z)-11-fluoro-9-azaspiro[5.7]tridec-12-en-8-yl]propanamide |
|---|---|
| PubChem CID | 155151048 |
| Molecular Formula | C32H57FN6O2 |
| Molecular Weight | 576.85 g/mol |
| Exact Mass | 576.45 |
| IUPAC Name | 3,3-diamino-N-[6-cyclohexyl-4-(4-methoxypiperidin-1-yl)piperidin-3-yl]-2-[(12Z)-11-fluoro-9-azaspiro[5.7]tridec-12-en-8-yl]propanamide |
| SMILES | COC1CCN(C2CC(C3CCCCC3)NCC2NC(=O)C(C(N)N)C2CC3(/C=C\C(F)CN2)CCCCC3)CC1 |
| InChI | InChI=1S/C32H57FN6O2/c1-41-24-11-16-39(17-12-24)28-18-25(22-8-4-2-5-9-22)37-21-27(28)38-31(40)29(30(34)35)26-19-32(13-6-3-7-14-32)15-10-23(33)20-36-26/h10,15,22-30,36-37H,2-9,11-14,16-21,34-35H2,1H3,(H,38,40)/b15-10- |
| InChIKey | QPIVFWFMYWZBPP-GDNBJRDFSA-N |
| XLogP | 2.96 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|