C13H14F3N3O — CID 155155080
1-(1-methylpyrrolo[3,2-c]pyridin-3-yl)-2-(3,3,3-trifluoropropylamino)ethanone (PubChem CID 155155080) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is 1-(1-methylpyrrolo[3,2-c]pyridin-3-yl)-2-(3,3,3-trifluoropropylamino)ethanone.
| Compound Name | 1-(1-methylpyrrolo[3,2-c]pyridin-3-yl)-2-(3,3,3-trifluoropropylamino)ethanone |
|---|---|
| PubChem CID | 155155080 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-(1-methylpyrrolo[3,2-c]pyridin-3-yl)-2-(3,3,3-trifluoropropylamino)ethanone |
| SMILES | Cn1cc(C(=O)CNCCC(F)(F)F)c2cnccc21 |
| InChI | InChI=1S/C13H14F3N3O/c1-19-8-10(9-6-17-4-2-11(9)19)12(20)7-18-5-3-13(14,15)16/h2,4,6,8,18H,3,5,7H2,1H3 |
| InChIKey | VSSPVIOAKFNLFJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|