C28H29N3O2S2 — CID 15516070
1-(naphthalen-1-ylmethyl)-3-[(1-naphthalen-1-ylsulfonylpiperidin-4-yl)methyl]thiourea (PubChem CID 15516070) has the molecular formula C28H29N3O2S2 and a molecular weight of 503.69 g/mol. Its IUPAC name is 1-(naphthalen-1-ylmethyl)-3-[(1-naphthalen-1-ylsulfonylpiperidin-4-yl)methyl]thiourea.
| Compound Name | 1-(naphthalen-1-ylmethyl)-3-[(1-naphthalen-1-ylsulfonylpiperidin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 15516070 |
| Molecular Formula | C28H29N3O2S2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 1-(naphthalen-1-ylmethyl)-3-[(1-naphthalen-1-ylsulfonylpiperidin-4-yl)methyl]thiourea |
| SMILES | O=S(=O)(c1cccc2ccccc12)N1CCC(CNC(=S)NCc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C28H29N3O2S2/c32-35(33,27-14-6-10-23-8-2-4-13-26(23)27)31-17-15-21(16-18-31)19-29-28(34)30-20-24-11-5-9-22-7-1-3-12-25(22)24/h1-14,21H,15-20H2,(H2,29,30,34) |
| InChIKey | IFCTZPWJMBOTMH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|