C10H16F6N2O5 — CID 155165177
4-(aminomethyl)piperidin-4-ol;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155165177) has the molecular formula C10H16F6N2O5 and a molecular weight of 358.24 g/mol. Its IUPAC name is 4-(aminomethyl)piperidin-4-ol;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-(aminomethyl)piperidin-4-ol;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155165177 |
| Molecular Formula | C10H16F6N2O5 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-(aminomethyl)piperidin-4-ol;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NCC1(O)CCNCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H14N2O.2C2HF3O2/c7-5-6(9)1-3-8-4-2-6;2*3-2(4,5)1(6)7/h8-9H,1-5,7H2;2*(H,6,7) |
| InChIKey | FSWIVDJOAVYVNX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |