C10H14F3NO4 — CID 169448913
1-oxa-8-azaspiro[4.5]decan-3-one;2,2,2-trifluoroacetic acid (PubChem CID 169448913) has the molecular formula C10H14F3NO4 and a molecular weight of 269.22 g/mol. Its IUPAC name is 1-oxa-8-azaspiro[4.5]decan-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-oxa-8-azaspiro[4.5]decan-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 169448913 |
| Molecular Formula | C10H14F3NO4 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-oxa-8-azaspiro[4.5]decan-3-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1COC2(CCNCC2)C1 |
| InChI | InChI=1S/C8H13NO2.C2HF3O2/c10-7-5-8(11-6-7)1-3-9-4-2-8;3-2(4,5)1(6)7/h9H,1-6H2;(H,6,7) |
| InChIKey | IPFXXTZZFONJMV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |