C22H24ClN9O2 — CID 155166100
(E)-2-[3-[[3-chloro-6-[(1-ethylpyrazol-4-yl)amino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]oxy]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile (PubChem CID 155166100) has the molecular formula C22H24ClN9O2 and a molecular weight of 481.95 g/mol. Its IUPAC name is (E)-2-[3-[[3-chloro-6-[(1-ethylpyrazol-4-yl)amino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]oxy]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile.
| Compound Name | (E)-2-[3-[[3-chloro-6-[(1-ethylpyrazol-4-yl)amino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]oxy]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
|---|---|
| PubChem CID | 155166100 |
| Molecular Formula | C22H24ClN9O2 |
| Molecular Weight | 481.95 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (E)-2-[3-[[3-chloro-6-[(1-ethylpyrazol-4-yl)amino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]oxy]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
| SMILES | CCn1cc(Nc2nc(OC3CCCN(C(=O)/C(C#N)=C/C4CC4)C3)c3c(Cl)[nH]nc3n2)cn1 |
| InChI | InChI=1S/C22H24ClN9O2/c1-2-32-11-15(10-25-32)26-22-27-19-17(18(23)29-30-19)20(28-22)34-16-4-3-7-31(12-16)21(33)14(9-24)8-13-5-6-13/h8,10-11,13,16H,2-7,12H2,1H3,(H2,26,27,28,29,30)/b14-8+ |
| InChIKey | VVHVBGGWKDGWBV-RIYZIHGNSA-N |
| XLogP | 3.20 |
| TPSA | 137.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.95 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|