C23H25ClN8OS — CID 155166004
(E)-2-[3-[[5-chloro-2-[(1-ethylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]sulfanyl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile (PubChem CID 155166004) has the molecular formula C23H25ClN8OS and a molecular weight of 497.03 g/mol. Its IUPAC name is (E)-2-[3-[[5-chloro-2-[(1-ethylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]sulfanyl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile.
| Compound Name | (E)-2-[3-[[5-chloro-2-[(1-ethylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]sulfanyl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
|---|---|
| PubChem CID | 155166004 |
| Molecular Formula | C23H25ClN8OS |
| Molecular Weight | 497.03 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (E)-2-[3-[[5-chloro-2-[(1-ethylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]sulfanyl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
| SMILES | CCn1cc(Nc2nc(SC3CCCN(C(=O)/C(C#N)=C/C4CC4)C3)c3c(Cl)c[nH]c3n2)cn1 |
| InChI | InChI=1S/C23H25ClN8OS/c1-2-32-12-16(10-27-32)28-23-29-20-19(18(24)11-26-20)21(30-23)34-17-4-3-7-31(13-17)22(33)15(9-25)8-14-5-6-14/h8,10-12,14,17H,2-7,13H2,1H3,(H2,26,28,29,30)/b15-8+ |
| InChIKey | GEJPAHVUBAZXIB-OVCLIPMQSA-N |
| XLogP | 4.51 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.03 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|