C7H12N2S — CID 155166805
(1R,5S)-2,4-diazabicyclo[3.3.1]nonane-3-thione (PubChem CID 155166805) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is (1R,5S)-2,4-diazabicyclo[3.3.1]nonane-3-thione.
| Compound Name | (1R,5S)-2,4-diazabicyclo[3.3.1]nonane-3-thione |
|---|---|
| PubChem CID | 155166805 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (1R,5S)-2,4-diazabicyclo[3.3.1]nonane-3-thione |
| SMILES | S=C1N[C@@H]2CCC[C@@H](C2)N1 |
| InChI | InChI=1S/C7H12N2S/c10-7-8-5-2-1-3-6(4-5)9-7/h5-6H,1-4H2,(H2,8,9,10)/t5-,6+ |
| InChIKey | GDOWVXGRLAQDNQ-OLQVQODUSA-N |
| XLogP | 0.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|