C7H12N2S — CID 3034715
1,3,4,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidine-2-thione (PubChem CID 3034715) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 1,3,4,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidine-2-thione.
| Compound Name | 1,3,4,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 3034715 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 1,3,4,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidine-2-thione |
| SMILES | S=C1NCC2CCCC2N1 |
| InChI | InChI=1S/C7H12N2S/c10-7-8-4-5-2-1-3-6(5)9-7/h5-6H,1-4H2,(H2,8,9,10) |
| InChIKey | LTPWXPXNKXNETK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|