5,5-dimethyloct-7-enoic acid

C10H18O2 — CID 155168828

IUPAC5,5-dimethyloct-7-enoic acid
SMILESC=CCC(C)(C)CCCC(=O)O
InChIInChI=1S/C10H18O2/c1-4-7-10(2,3)8-5-6-9(11)12/h4H,1,5-8H2,2-3H3,(H,11,12)
InChIKeyYOPAESWFKQGOAD-UHFFFAOYSA-N
MW170.25 g/mol
LogP2.84
Rot. Bonds6

About 5,5-dimethyloct-7-enoic acid

5,5-dimethyloct-7-enoic acid (PubChem CID 155168828) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 5,5-dimethyloct-7-enoic acid.

Molecular Properties

Compound Name5,5-dimethyloct-7-enoic acid
PubChem CID155168828
Molecular FormulaC10H18O2
Molecular Weight170.25 g/mol
Exact Mass170.13
IUPAC Name5,5-dimethyloct-7-enoic acid
SMILESC=CCC(C)(C)CCCC(=O)O
InChIInChI=1S/C10H18O2/c1-4-7-10(2,3)8-5-6-9(11)12/h4H,1,5-8H2,2-3H3,(H,11,12)
InChIKeyYOPAESWFKQGOAD-UHFFFAOYSA-N
XLogP2.84
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.25
LogP ≤ 52.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 5,5-dimethyloct-7-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-dimethyloct-7-enoic acid?
The IUPAC name of 5,5-dimethyloct-7-enoic acid (CID 155168828) is 5,5-dimethyloct-7-enoic acid.
What is the SMILES notation for 5,5-dimethyloct-7-enoic acid?
The canonical SMILES for 5,5-dimethyloct-7-enoic acid is C=CCC(C)(C)CCCC(=O)O.
What is the InChIKey of 5,5-dimethyloct-7-enoic acid?
The InChIKey is YOPAESWFKQGOAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-4-7-10(2,3)8-5-6-9(11)12/h4H,1,5-8H2,2-3H3,(H,11,12).
What are the key properties of 5,5-dimethyloct-7-enoic acid?
5,5-dimethyloct-7-enoic acid has a molecular weight of 170.25 g/mol, XLogP of 2.84, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyloct-7-enoic acid is sourced from PubChem (CID 155168828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).