C12H15FINO — CID 155172642
[1-(2-fluoro-4-iodophenyl)piperidin-4-yl]methanol (PubChem CID 155172642) has the molecular formula C12H15FINO and a molecular weight of 335.16 g/mol. Its IUPAC name is [1-(2-fluoro-4-iodophenyl)piperidin-4-yl]methanol.
| Compound Name | [1-(2-fluoro-4-iodophenyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 155172642 |
| Molecular Formula | C12H15FINO |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | [1-(2-fluoro-4-iodophenyl)piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2ccc(I)cc2F)CC1 |
| InChI | InChI=1S/C12H15FINO/c13-11-7-10(14)1-2-12(11)15-5-3-9(8-16)4-6-15/h1-2,7,9,16H,3-6,8H2 |
| InChIKey | CWLWEGFOEXASQB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|