C14H32N2O4P2S2 — CID 15517377
trans-(1R,2R)-1-N,2-N-bis(diethoxyphosphinothioyl)cyclohexane-1,2-diamine (PubChem CID 15517377) has the molecular formula C14H32N2O4P2S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-bis(diethoxyphosphinothioyl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-bis(diethoxyphosphinothioyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 15517377 |
| Molecular Formula | C14H32N2O4P2S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-bis(diethoxyphosphinothioyl)cyclohexane-1,2-diamine |
| SMILES | CCOP(=S)(N[C@@H]1CCCC[C@H]1NP(=S)(OCC)OCC)OCC |
| InChI | InChI=1S/C14H32N2O4P2S2/c1-5-17-21(23,18-6-2)15-13-11-9-10-12-14(13)16-22(24,19-7-3)20-8-4/h13-14H,5-12H2,1-4H3,(H,15,23)(H,16,24)/t13-,14-/m1/s1 |
| InChIKey | IAQVCCJHMNRFJC-ZIAGYGMSSA-N |
| XLogP | 4.07 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|