C11H23N2O4P — CID 87738917
N-[(1S,2R)-2-aminocyclohexyl]-1-diethoxyphosphorylformamide (PubChem CID 87738917) has the molecular formula C11H23N2O4P and a molecular weight of 278.29 g/mol. Its IUPAC name is N-[(1S,2R)-2-aminocyclohexyl]-1-diethoxyphosphorylformamide.
| Compound Name | N-[(1S,2R)-2-aminocyclohexyl]-1-diethoxyphosphorylformamide |
|---|---|
| PubChem CID | 87738917 |
| Molecular Formula | C11H23N2O4P |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[(1S,2R)-2-aminocyclohexyl]-1-diethoxyphosphorylformamide |
| SMILES | CCOP(=O)(OCC)C(=O)N[C@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C11H23N2O4P/c1-3-16-18(15,17-4-2)11(14)13-10-8-6-5-7-9(10)12/h9-10H,3-8,12H2,1-2H3,(H,13,14)/t9-,10+/m1/s1 |
| InChIKey | LNEGGXHAOINNOL-ZJUUUORDSA-N |
| XLogP | 2.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|