C20H23ClFN7O2S — CID 155174359
N,N'-diamino-2-chloro-5-[[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)propyl]amino]sulfanylbenzenecarboximidamide (PubChem CID 155174359) has the molecular formula C20H23ClFN7O2S and a molecular weight of 479.97 g/mol. Its IUPAC name is N,N'-diamino-2-chloro-5-[[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)propyl]amino]sulfanylbenzenecarboximidamide.
| Compound Name | N,N'-diamino-2-chloro-5-[[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)propyl]amino]sulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 155174359 |
| Molecular Formula | C20H23ClFN7O2S |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N,N'-diamino-2-chloro-5-[[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)propyl]amino]sulfanylbenzenecarboximidamide |
| SMILES | Cc1ccc(F)c(C(C)C(NSc2ccc(Cl)c(/C(=N/N)NN)c2)c2n[nH]c(=O)o2)c1C |
| InChI | InChI=1S/C20H23ClFN7O2S/c1-9-4-7-15(22)16(10(9)2)11(3)17(19-27-28-20(30)31-19)29-32-12-5-6-14(21)13(8-12)18(25-23)26-24/h4-8,11,17,29H,23-24H2,1-3H3,(H,25,26)(H,28,30) |
| InChIKey | VFACWZFMIZNFPF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|