C20H20ClFN4O4S — CID 145411153
5-chloro-2-[[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)propyl]amino]sulfanyl-N-hydroxybenzamide (PubChem CID 145411153) has the molecular formula C20H20ClFN4O4S and a molecular weight of 466.92 g/mol. Its IUPAC name is 5-chloro-2-[[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)propyl]amino]sulfanyl-N-hydroxybenzamide.
| Compound Name | 5-chloro-2-[[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)propyl]amino]sulfanyl-N-hydroxybenzamide |
|---|---|
| PubChem CID | 145411153 |
| Molecular Formula | C20H20ClFN4O4S |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 5-chloro-2-[[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)propyl]amino]sulfanyl-N-hydroxybenzamide |
| SMILES | Cc1ccc(F)c(C(C)C(NSc2ccc(Cl)cc2C(=O)NO)c2n[nH]c(=O)o2)c1C |
| InChI | InChI=1S/C20H20ClFN4O4S/c1-9-4-6-14(22)16(10(9)2)11(3)17(19-23-24-20(28)30-19)26-31-15-7-5-12(21)8-13(15)18(27)25-29/h4-8,11,17,26,29H,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | HBBBUWNZERNXLS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|