C21H20B2ClFN4O5S — CID 171096400
CID 171096400 (PubChem CID 171096400) has the molecular formula C21H20B2ClFN4O5S and a molecular weight of 516.56 g/mol.
| Compound Name | CID 171096400 |
|---|---|
| PubChem CID | 171096400 |
| Molecular Formula | C21H20B2ClFN4O5S |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)N1CN(C(c2n[nH]c(=O)o2)[C@H](C)c2c(F)ccc(C)c2C)S(=O)(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H20B2ClFN4O5S/c1-10-4-6-14(25)17(11(10)2)12(3)18(19-26-27-20(30)34-19)29-9-28(21(22,23)31)15-8-13(24)5-7-16(15)35(29,32)33/h4-8,12,18,31H,9H2,1-3H3,(H,27,30)/t12-,18?/m1/s1 |
| InChIKey | GRSXOXFETOMWNL-GKOGFXNCSA-N |
| XLogP | 2.03 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|