C22H24ClFN4O4S — CID 171096538
5-[(1S,2R)-1-(6-chloro-4,7-dimethyl-1,1-dioxo-3H-1λ6,2,4-benzothiadiazin-2-yl)-2-(6-fluoro-2,3-dimethylphenyl)propyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 171096538) has the molecular formula C22H24ClFN4O4S and a molecular weight of 494.98 g/mol. Its IUPAC name is 5-[(1S,2R)-1-(6-chloro-4,7-dimethyl-1,1-dioxo-3H-1λ6,2,4-benzothiadiazin-2-yl)-2-(6-fluoro-2,3-dimethylphenyl)propyl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[(1S,2R)-1-(6-chloro-4,7-dimethyl-1,1-dioxo-3H-1λ6,2,4-benzothiadiazin-2-yl)-2-(6-fluoro-2,3-dimethylphenyl)propyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 171096538 |
| Molecular Formula | C22H24ClFN4O4S |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 5-[(1S,2R)-1-(6-chloro-4,7-dimethyl-1,1-dioxo-3H-1λ6,2,4-benzothiadiazin-2-yl)-2-(6-fluoro-2,3-dimethylphenyl)propyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | Cc1cc2c(cc1Cl)N(C)CN([C@H](c1n[nH]c(=O)o1)[C@H](C)c1c(F)ccc(C)c1C)S2(=O)=O |
| InChI | InChI=1S/C22H24ClFN4O4S/c1-11-6-7-16(24)19(13(11)3)14(4)20(21-25-26-22(29)32-21)28-10-27(5)17-9-15(23)12(2)8-18(17)33(28,30)31/h6-9,14,20H,10H2,1-5H3,(H,26,29)/t14-,20+/m1/s1 |
| InChIKey | CHYKSJRCRYNRSJ-VLIAUNLRSA-N |
| XLogP | 4.02 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |