C19H22ClN5 — CID 155175750
5-chloro-N-methyl-6-(4-pyrrolidin-2-ylimidazol-1-yl)spiro[1H-indole-3,1'-cyclobutane]-2-imine (PubChem CID 155175750) has the molecular formula C19H22ClN5 and a molecular weight of 355.87 g/mol. Its IUPAC name is 5-chloro-N-methyl-6-(4-pyrrolidin-2-ylimidazol-1-yl)spiro[1H-indole-3,1'-cyclobutane]-2-imine.
| Compound Name | 5-chloro-N-methyl-6-(4-pyrrolidin-2-ylimidazol-1-yl)spiro[1H-indole-3,1'-cyclobutane]-2-imine |
|---|---|
| PubChem CID | 155175750 |
| Molecular Formula | C19H22ClN5 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 5-chloro-N-methyl-6-(4-pyrrolidin-2-ylimidazol-1-yl)spiro[1H-indole-3,1'-cyclobutane]-2-imine |
| SMILES | C/N=C1\Nc2cc(-n3cnc(C4CCCN4)c3)c(Cl)cc2C12CCC2 |
| InChI | InChI=1S/C19H22ClN5/c1-21-18-19(5-3-6-19)12-8-13(20)17(9-15(12)24-18)25-10-16(23-11-25)14-4-2-7-22-14/h8-11,14,22H,2-7H2,1H3,(H,21,24) |
| InChIKey | MACRJWJDDGLQNZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|