C19H23ClN6 — CID 148522262
5-chloro-N-methyl-6-(4-piperidin-2-yltriazol-1-yl)spiro[1H-indole-3,1'-cyclobutane]-2-imine (PubChem CID 148522262) has the molecular formula C19H23ClN6 and a molecular weight of 370.89 g/mol. Its IUPAC name is 5-chloro-N-methyl-6-(4-piperidin-2-yltriazol-1-yl)spiro[1H-indole-3,1'-cyclobutane]-2-imine.
| Compound Name | 5-chloro-N-methyl-6-(4-piperidin-2-yltriazol-1-yl)spiro[1H-indole-3,1'-cyclobutane]-2-imine |
|---|---|
| PubChem CID | 148522262 |
| Molecular Formula | C19H23ClN6 |
| Molecular Weight | 370.89 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 5-chloro-N-methyl-6-(4-piperidin-2-yltriazol-1-yl)spiro[1H-indole-3,1'-cyclobutane]-2-imine |
| SMILES | C/N=C1\Nc2cc(-n3cc(C4CCCCN4)nn3)c(Cl)cc2C12CCC2 |
| InChI | InChI=1S/C19H23ClN6/c1-21-18-19(6-4-7-19)12-9-13(20)17(10-15(12)23-18)26-11-16(24-25-26)14-5-2-3-8-22-14/h9-11,14,22H,2-8H2,1H3,(H,21,23) |
| InChIKey | MOQJFBQMWHYWQK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.89 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|