C12H17NO5 — CID 155176052
ethyl 3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-imino-3-oxopropanoate (PubChem CID 155176052) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is ethyl 3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-imino-3-oxopropanoate.
| Compound Name | ethyl 3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-imino-3-oxopropanoate |
|---|---|
| PubChem CID | 155176052 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | ethyl 3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-imino-3-oxopropanoate |
| SMILES | [H]/N=C(\C(=O)OCC)C(=O)[C@H]1OC(C)(C)O[C@H]1C=C |
| InChI | InChI=1S/C12H17NO5/c1-5-7-10(18-12(3,4)17-7)9(14)8(13)11(15)16-6-2/h5,7,10,13H,1,6H2,2-4H3/b13-8-/t7-,10-/m0/s1 |
| InChIKey | PRAPIMDVAZKDCB-JKPPCSAVSA-N |
| XLogP | 0.84 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|