C15H18O4 — CID 101493909
[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-(2-methoxyphenyl)methanone (PubChem CID 101493909) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is [(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 101493909 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-(2-methoxyphenyl)methanone |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1C(=O)c1ccccc1OC |
| InChI | InChI=1S/C15H18O4/c1-5-11-14(19-15(2,3)18-11)13(16)10-8-6-7-9-12(10)17-4/h5-9,11,14H,1H2,2-4H3/t11-,14-/m1/s1 |
| InChIKey | RTURAZANYJGIAH-BXUZGUMPSA-N |
| XLogP | 2.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|