C19H17Cl2N5OS — CID 155176709
5-chloro-N-[2-[5-(2-chlorophenyl)-1,4-dimethylpyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 155176709) has the molecular formula C19H17Cl2N5OS and a molecular weight of 434.35 g/mol. Its IUPAC name is 5-chloro-N-[2-[5-(2-chlorophenyl)-1,4-dimethylpyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-chloro-N-[2-[5-(2-chlorophenyl)-1,4-dimethylpyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155176709 |
| Molecular Formula | C19H17Cl2N5OS |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 5-chloro-N-[2-[5-(2-chlorophenyl)-1,4-dimethylpyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1c(OCCNc2ncnc3scc(Cl)c23)nn(C)c1-c1ccccc1Cl |
| InChI | InChI=1S/C19H17Cl2N5OS/c1-11-16(12-5-3-4-6-13(12)20)26(2)25-18(11)27-8-7-22-17-15-14(21)9-28-19(15)24-10-23-17/h3-6,9-10H,7-8H2,1-2H3,(H,22,23,24) |
| InChIKey | FCABUKSFKNCUTJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|