C28H28ClF2N5O5 — CID 155177391
(2Z)-N-[4-[(2-amino-3-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-N'-(4-fluorophenyl)-2-[[formyl(2-propan-2-yloxyethyl)amino]methylidene]-N'-methylpropanediamide (PubChem CID 155177391) has the molecular formula C28H28ClF2N5O5 and a molecular weight of 588.01 g/mol. Its IUPAC name is (2Z)-N-[4-[(2-amino-3-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-N'-(4-fluorophenyl)-2-[[formyl(2-propan-2-yloxyethyl)amino]methylidene]-N'-methylpropanediamide.
| Compound Name | (2Z)-N-[4-[(2-amino-3-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-N'-(4-fluorophenyl)-2-[[formyl(2-propan-2-yloxyethyl)amino]methylidene]-N'-methylpropanediamide |
|---|---|
| PubChem CID | 155177391 |
| Molecular Formula | C28H28ClF2N5O5 |
| Molecular Weight | 588.01 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | (2Z)-N-[4-[(2-amino-3-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-N'-(4-fluorophenyl)-2-[[formyl(2-propan-2-yloxyethyl)amino]methylidene]-N'-methylpropanediamide |
| SMILES | CC(C)OCCN(C=O)/C=C(/C(=O)Nc1ccc(Oc2ccnc(N)c2Cl)c(F)c1)C(=O)N(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H28ClF2N5O5/c1-17(2)40-13-12-36(16-37)15-21(28(39)35(3)20-7-4-18(30)5-8-20)27(38)34-19-6-9-23(22(31)14-19)41-24-10-11-33-26(32)25(24)29/h4-11,14-17H,12-13H2,1-3H3,(H2,32,33)(H,34,38)/b21-15- |
| InChIKey | VYWCDAVWDXISDN-QNGOZBTKSA-N |
| XLogP | 4.76 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.01 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|