C14H30N2 — CID 155177418
N'-(2,4,4,5,5-pentamethylhexan-2-yl)propanimidamide (PubChem CID 155177418) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is N'-(2,4,4,5,5-pentamethylhexan-2-yl)propanimidamide.
| Compound Name | N'-(2,4,4,5,5-pentamethylhexan-2-yl)propanimidamide |
|---|---|
| PubChem CID | 155177418 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N'-(2,4,4,5,5-pentamethylhexan-2-yl)propanimidamide |
| SMILES | CC/C(N)=N\C(C)(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30N2/c1-9-11(15)16-14(7,8)10-13(5,6)12(2,3)4/h9-10H2,1-8H3,(H2,15,16) |
| InChIKey | NPIZQONEAMONFH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|