C37H50F3N3O5 — CID 155178527
4-N-[2,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]quinolin-8-yl]-1-N-[(3R)-3-ethyl-3-pent-4-en-2-ylperoxycyclohexyl]pentane-1,4-diamine (PubChem CID 155178527) has the molecular formula C37H50F3N3O5 and a molecular weight of 673.82 g/mol. Its IUPAC name is 4-N-[2,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]quinolin-8-yl]-1-N-[(3R)-3-ethyl-3-pent-4-en-2-ylperoxycyclohexyl]pentane-1,4-diamine.
| Compound Name | 4-N-[2,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]quinolin-8-yl]-1-N-[(3R)-3-ethyl-3-pent-4-en-2-ylperoxycyclohexyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 155178527 |
| Molecular Formula | C37H50F3N3O5 |
| Molecular Weight | 673.82 g/mol |
| Exact Mass | 673.37 |
| IUPAC Name | 4-N-[2,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]quinolin-8-yl]-1-N-[(3R)-3-ethyl-3-pent-4-en-2-ylperoxycyclohexyl]pentane-1,4-diamine |
| SMILES | C=CCC(C)OO[C@]1(CC)CCCC(NCCCC(C)Nc2cc(OC)c(Oc3cccc(C(F)(F)F)c3)c3c(C)cc(OC)nc23)C1 |
| InChI | InChI=1S/C37H50F3N3O5/c1-8-13-26(5)47-48-36(9-2)18-11-16-28(23-36)41-19-12-14-25(4)42-30-22-31(44-6)35(33-24(3)20-32(45-7)43-34(30)33)46-29-17-10-15-27(21-29)37(38,39)40/h8,10,15,17,20-22,25-26,28,41-42H,1,9,11-14,16,18-19,23H2,2-7H3/t25?,26?,28?,36-/m1/s1 |
| InChIKey | UXGJMIBFVHSTHD-LJOIOFCNSA-N |
| XLogP | 9.55 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.82 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|