C29H36F3N3O5 — CID 69411664
tert-butyl N-[4-[[1,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]isoquinolin-8-yl]amino]pentyl]carbamate (PubChem CID 69411664) has the molecular formula C29H36F3N3O5 and a molecular weight of 563.62 g/mol. Its IUPAC name is tert-butyl N-[4-[[1,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]isoquinolin-8-yl]amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[4-[[1,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]isoquinolin-8-yl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 69411664 |
| Molecular Formula | C29H36F3N3O5 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | tert-butyl N-[4-[[1,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]isoquinolin-8-yl]amino]pentyl]carbamate |
| SMILES | COc1cc(NC(C)CCCNC(=O)OC(C)(C)C)c2c(OC)ncc(C)c2c1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H36F3N3O5/c1-17-16-34-26(38-7)24-21(35-18(2)10-9-13-33-27(36)40-28(3,4)5)15-22(37-6)25(23(17)24)39-20-12-8-11-19(14-20)29(30,31)32/h8,11-12,14-16,18,35H,9-10,13H2,1-7H3,(H,33,36) |
| InChIKey | CHVWJPCHACYTIO-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|