C11H17N3O4 — CID 15518557
(2S)-2-amino-6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexanoic acid (PubChem CID 15518557) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is (2S)-2-amino-6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexanoic acid.
| Compound Name | (2S)-2-amino-6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 15518557 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | (2S)-2-amino-6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexanoic acid |
| SMILES | Cc1cn(CCCC[C@H](N)C(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N3O4/c1-7-6-14(11(18)13-9(7)15)5-3-2-4-8(12)10(16)17/h6,8H,2-5,12H2,1H3,(H,16,17)(H,13,15,18)/t8-/m0/s1 |
| InChIKey | SWTDKCIDPQYUCZ-QMMMGPOBSA-N |
| XLogP | -0.57 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|