C11H14FN3O5 — CID 12849074
6-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]hexanoic acid (PubChem CID 12849074) has the molecular formula C11H14FN3O5 and a molecular weight of 287.25 g/mol. Its IUPAC name is 6-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 12849074 |
| Molecular Formula | C11H14FN3O5 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 6-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H14FN3O5/c12-7-6-15(11(20)14-9(7)18)10(19)13-5-3-1-2-4-8(16)17/h6H,1-5H2,(H,13,19)(H,16,17)(H,14,18,20) |
| InChIKey | ZEPNMXGMZWKESH-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|