C42H45NO7S — CID 155187375
10-[4-[4-[6-(4-butan-2-ylphenoxy)hexoxy]phenyl]sulfonylphenyl]-3,7-dimethoxyphenoxazine (PubChem CID 155187375) has the molecular formula C42H45NO7S and a molecular weight of 707.89 g/mol. Its IUPAC name is 10-[4-[4-[6-(4-butan-2-ylphenoxy)hexoxy]phenyl]sulfonylphenyl]-3,7-dimethoxyphenoxazine.
| Compound Name | 10-[4-[4-[6-(4-butan-2-ylphenoxy)hexoxy]phenyl]sulfonylphenyl]-3,7-dimethoxyphenoxazine |
|---|---|
| PubChem CID | 155187375 |
| Molecular Formula | C42H45NO7S |
| Molecular Weight | 707.89 g/mol |
| Exact Mass | 707.29 |
| IUPAC Name | 10-[4-[4-[6-(4-butan-2-ylphenoxy)hexoxy]phenyl]sulfonylphenyl]-3,7-dimethoxyphenoxazine |
| SMILES | CCC(C)c1ccc(OCCCCCCOc2ccc(S(=O)(=O)c3ccc(N4c5ccc(OC)cc5Oc5cc(OC)ccc54)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H45NO7S/c1-5-30(2)31-10-14-33(15-11-31)48-26-8-6-7-9-27-49-34-16-22-38(23-17-34)51(44,45)37-20-12-32(13-21-37)43-39-24-18-35(46-3)28-41(39)50-42-29-36(47-4)19-25-40(42)43/h10-25,28-30H,5-9,26-27H2,1-4H3 |
| InChIKey | BRQNTGAPTZPLBS-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.89 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|