C40H41NO5S — CID 155187506
10-[4-[4-[6-(4-butan-2-ylphenoxy)hexoxy]phenyl]sulfonylphenyl]phenoxazine (PubChem CID 155187506) has the molecular formula C40H41NO5S and a molecular weight of 647.84 g/mol. Its IUPAC name is 10-[4-[4-[6-(4-butan-2-ylphenoxy)hexoxy]phenyl]sulfonylphenyl]phenoxazine.
| Compound Name | 10-[4-[4-[6-(4-butan-2-ylphenoxy)hexoxy]phenyl]sulfonylphenyl]phenoxazine |
|---|---|
| PubChem CID | 155187506 |
| Molecular Formula | C40H41NO5S |
| Molecular Weight | 647.84 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | 10-[4-[4-[6-(4-butan-2-ylphenoxy)hexoxy]phenyl]sulfonylphenyl]phenoxazine |
| SMILES | CCC(C)c1ccc(OCCCCCCOc2ccc(S(=O)(=O)c3ccc(N4c5ccccc5Oc5ccccc54)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H41NO5S/c1-3-30(2)31-16-20-33(21-17-31)44-28-10-4-5-11-29-45-34-22-26-36(27-23-34)47(42,43)35-24-18-32(19-25-35)41-37-12-6-8-14-39(37)46-40-15-9-7-13-38(40)41/h6-9,12-27,30H,3-5,10-11,28-29H2,1-2H3 |
| InChIKey | WOQWNJUAOGUSRI-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.84 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|