C13H17NOSe — CID 15518770
6,6-dimethyl-2-(4-methylphenyl)-4,5-dihydro-1,3-selenazin-4-ol (PubChem CID 15518770) has the molecular formula C13H17NOSe and a molecular weight of 282.25 g/mol. Its IUPAC name is 6,6-dimethyl-2-(4-methylphenyl)-4,5-dihydro-1,3-selenazin-4-ol.
| Compound Name | 6,6-dimethyl-2-(4-methylphenyl)-4,5-dihydro-1,3-selenazin-4-ol |
|---|---|
| PubChem CID | 15518770 |
| Molecular Formula | C13H17NOSe |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 6,6-dimethyl-2-(4-methylphenyl)-4,5-dihydro-1,3-selenazin-4-ol |
| SMILES | Cc1ccc(C2=NC(O)CC(C)(C)[Se]2)cc1 |
| InChI | InChI=1S/C13H17NOSe/c1-9-4-6-10(7-5-9)12-14-11(15)8-13(2,3)16-12/h4-7,11,15H,8H2,1-3H3 |
| InChIKey | MSZHRSFYVZNKNV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|