C17H25NOSe — CID 14595834
2,6-ditert-butyl-4-phenyl-6H-1,3,5-oxaselenazine (PubChem CID 14595834) has the molecular formula C17H25NOSe and a molecular weight of 338.35 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-phenyl-6H-1,3,5-oxaselenazine.
| Compound Name | 2,6-ditert-butyl-4-phenyl-6H-1,3,5-oxaselenazine |
|---|---|
| PubChem CID | 14595834 |
| Molecular Formula | C17H25NOSe |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2,6-ditert-butyl-4-phenyl-6H-1,3,5-oxaselenazine |
| SMILES | CC(C)(C)C1N=C(c2ccccc2)[Se]C(C(C)(C)C)O1 |
| InChI | InChI=1S/C17H25NOSe/c1-16(2,3)14-18-13(12-10-8-7-9-11-12)20-15(19-14)17(4,5)6/h7-11,14-15H,1-6H3 |
| InChIKey | XTJMBKRBJPECES-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|